C15H19ClNO3+ — CID 144748292
3-(7,8-dimethoxy-2-oxo-1H-3-benzazepin-3-yl)propylchloranium (PubChem CID 144748292) has the molecular formula C15H19ClNO3+ and a molecular weight of 296.77 g/mol. Its IUPAC name is 3-(7,8-dimethoxy-2-oxo-1H-3-benzazepin-3-yl)propylchloranium.
| Compound Name | 3-(7,8-dimethoxy-2-oxo-1H-3-benzazepin-3-yl)propylchloranium |
|---|---|
| PubChem CID | 144748292 |
| Molecular Formula | C15H19ClNO3+ |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-(7,8-dimethoxy-2-oxo-1H-3-benzazepin-3-yl)propylchloranium |
| SMILES | COc1cc2c(cc1OC)CC(=O)N(CCC[ClH+])C=C2 |
| InChI | InChI=1S/C15H19ClNO3/c1-19-13-8-11-4-7-17(6-3-5-16)15(18)10-12(11)9-14(13)20-2/h4,7-9,16H,3,5-6,10H2,1-2H3/q+1 |
| InChIKey | CGDOUQIPMTZCJX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|