C29H40N2O5 — CID 13319937
3-[3-[5-(3,4-dimethoxyphenyl)pentyl-methylamino]propyl]-7,8-dimethoxy-1H-3-benzazepin-2-one (PubChem CID 13319937) has the molecular formula C29H40N2O5 and a molecular weight of 496.65 g/mol. Its IUPAC name is 3-[3-[5-(3,4-dimethoxyphenyl)pentyl-methylamino]propyl]-7,8-dimethoxy-1H-3-benzazepin-2-one.
| Compound Name | 3-[3-[5-(3,4-dimethoxyphenyl)pentyl-methylamino]propyl]-7,8-dimethoxy-1H-3-benzazepin-2-one |
|---|---|
| PubChem CID | 13319937 |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | 3-[3-[5-(3,4-dimethoxyphenyl)pentyl-methylamino]propyl]-7,8-dimethoxy-1H-3-benzazepin-2-one |
| SMILES | COc1ccc(CCCCCN(C)CCCN2C=Cc3cc(OC)c(OC)cc3CC2=O)cc1OC |
| InChI | InChI=1S/C29H40N2O5/c1-30(14-8-6-7-10-22-11-12-25(33-2)26(18-22)34-3)15-9-16-31-17-13-23-19-27(35-4)28(36-5)20-24(23)21-29(31)32/h11-13,17-20H,6-10,14-16,21H2,1-5H3 |
| InChIKey | ZYMUENUYBAJOCC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|