C15H23N3O2 — CID 115309539
methyl 2-[(2-amino-1-cyclohexylethyl)amino]pyridine-3-carboxylate (PubChem CID 115309539) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is methyl 2-[(2-amino-1-cyclohexylethyl)amino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[(2-amino-1-cyclohexylethyl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 115309539 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | methyl 2-[(2-amino-1-cyclohexylethyl)amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1NC(CN)C1CCCCC1 |
| InChI | InChI=1S/C15H23N3O2/c1-20-15(19)12-8-5-9-17-14(12)18-13(10-16)11-6-3-2-4-7-11/h5,8-9,11,13H,2-4,6-7,10,16H2,1H3,(H,17,18) |
| InChIKey | GRFFALPPAUFBKS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |