C15H22F2N2O2 — CID 115309796
N-(1-amino-2,4-dimethylpentan-2-yl)-2-(difluoromethoxy)benzamide (PubChem CID 115309796) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-2-(difluoromethoxy)benzamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 115309796 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-(difluoromethoxy)benzamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H22F2N2O2/c1-10(2)8-15(3,9-18)19-13(20)11-6-4-5-7-12(11)21-14(16)17/h4-7,10,14H,8-9,18H2,1-3H3,(H,19,20) |
| InChIKey | KYQNUVDBJQQRME-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |