C18H18Cl2N2OS — CID 11531028
1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)thiourea (PubChem CID 11531028) has the molecular formula C18H18Cl2N2OS and a molecular weight of 381.33 g/mol. Its IUPAC name is 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 11531028 |
| Molecular Formula | C18H18Cl2N2OS |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)thiourea |
| SMILES | CC1(C)CC(NC(=S)Nc2ccc(Cl)cc2)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C18H18Cl2N2OS/c1-18(2)10-15(14-9-12(20)5-8-16(14)23-18)22-17(24)21-13-6-3-11(19)4-7-13/h3-9,15H,10H2,1-2H3,(H2,21,22,24) |
| InChIKey | SKUYPXYVTWCBMM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|