C22H20N4O3 — CID 11531187
1-[8-acetyl-13-(benzylamino)-6-methoxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaen-11-yl]ethanone (PubChem CID 11531187) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 1-[8-acetyl-13-(benzylamino)-6-methoxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaen-11-yl]ethanone.
| Compound Name | 1-[8-acetyl-13-(benzylamino)-6-methoxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaen-11-yl]ethanone |
|---|---|
| PubChem CID | 11531187 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-[8-acetyl-13-(benzylamino)-6-methoxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaen-11-yl]ethanone |
| SMILES | COc1ccnc2c1c(C(C)=O)c1cc(C(C)=O)nc(NCc3ccccc3)n12 |
| InChI | InChI=1S/C22H20N4O3/c1-13(27)16-11-17-19(14(2)28)20-18(29-3)9-10-23-21(20)26(17)22(25-16)24-12-15-7-5-4-6-8-15/h4-11H,12H2,1-3H3,(H,24,25) |
| InChIKey | JGPFVSCNFWVIMD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |