C18H26N2O — CID 115313816
3-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol (PubChem CID 115313816) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 3-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 115313816 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1ccc(O)c2c1C(C)CC2N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C18H26N2O/c1-11-3-6-16(21)18-15(9-12(2)17(11)18)20-8-7-13-4-5-14(10-20)19-13/h3,6,12-15,19,21H,4-5,7-10H2,1-2H3 |
| InChIKey | RAVLMULSTWBAFS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|