C18H28N2O — CID 43203893
1,7-dimethyl-3-(3-pyrrolidin-1-ylpropylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 43203893) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 1,7-dimethyl-3-(3-pyrrolidin-1-ylpropylamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1,7-dimethyl-3-(3-pyrrolidin-1-ylpropylamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43203893 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 1,7-dimethyl-3-(3-pyrrolidin-1-ylpropylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1ccc(O)c2c1C(C)CC2NCCCN1CCCC1 |
| InChI | InChI=1S/C18H28N2O/c1-13-6-7-16(21)18-15(12-14(2)17(13)18)19-8-5-11-20-9-3-4-10-20/h6-7,14-15,19,21H,3-5,8-12H2,1-2H3 |
| InChIKey | PJSKQVXPSLZJSA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|