C19H23NO2 — CID 43824319
3-[(4-methoxyphenyl)methylamino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol (PubChem CID 43824319) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methylamino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 3-[(4-methoxyphenyl)methylamino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43824319 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-[(4-methoxyphenyl)methylamino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
| SMILES | COc1ccc(CNC2CC(C)c3c(C)ccc(O)c32)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-12-4-9-17(21)19-16(10-13(2)18(12)19)20-11-14-5-7-15(22-3)8-6-14/h4-9,13,16,20-21H,10-11H2,1-3H3 |
| InChIKey | IPONMZGVAKVFSP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|