C16H21NO — CID 104582781
1,7-dimethyl-3-(pent-4-ynylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 104582781) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 1,7-dimethyl-3-(pent-4-ynylamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1,7-dimethyl-3-(pent-4-ynylamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 104582781 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 1,7-dimethyl-3-(pent-4-ynylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | C#CCCCNC1CC(C)c2c(C)ccc(O)c21 |
| InChI | InChI=1S/C16H21NO/c1-4-5-6-9-17-13-10-12(3)15-11(2)7-8-14(18)16(13)15/h1,7-8,12-13,17-18H,5-6,9-10H2,2-3H3 |
| InChIKey | IGMZNFSDDQLSNS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|