C16H25NOS — CID 104582862
1,7-dimethyl-3-[(2-methyl-2-methylsulfanylpropyl)amino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 104582862) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is 1,7-dimethyl-3-[(2-methyl-2-methylsulfanylpropyl)amino]-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1,7-dimethyl-3-[(2-methyl-2-methylsulfanylpropyl)amino]-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 104582862 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1,7-dimethyl-3-[(2-methyl-2-methylsulfanylpropyl)amino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | CSC(C)(C)CNC1CC(C)c2c(C)ccc(O)c21 |
| InChI | InChI=1S/C16H25NOS/c1-10-6-7-13(18)15-12(8-11(2)14(10)15)17-9-16(3,4)19-5/h6-7,11-12,17-18H,8-9H2,1-5H3 |
| InChIKey | VSZAXQYQNBZJPM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|