C22H24ClNO4 — CID 11531460
2-[4-chloro-3-[(1-hydroxycycloheptyl)methylcarbamoyl]phenyl]benzoic acid (PubChem CID 11531460) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is 2-[4-chloro-3-[(1-hydroxycycloheptyl)methylcarbamoyl]phenyl]benzoic acid.
| Compound Name | 2-[4-chloro-3-[(1-hydroxycycloheptyl)methylcarbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 11531460 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-[4-chloro-3-[(1-hydroxycycloheptyl)methylcarbamoyl]phenyl]benzoic acid |
| SMILES | O=C(NCC1(O)CCCCCC1)c1cc(-c2ccccc2C(=O)O)ccc1Cl |
| InChI | InChI=1S/C22H24ClNO4/c23-19-10-9-15(16-7-3-4-8-17(16)21(26)27)13-18(19)20(25)24-14-22(28)11-5-1-2-6-12-22/h3-4,7-10,13,28H,1-2,5-6,11-12,14H2,(H,24,25)(H,26,27) |
| InChIKey | KWDRPQHLCCZECW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |