C19H16ClNO2 — CID 56764106
2-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)benzamide (PubChem CID 56764106) has the molecular formula C19H16ClNO2 and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)benzamide.
| Compound Name | 2-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 56764106 |
| Molecular Formula | C19H16ClNO2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-chloro-N-(2-hydroxy-2-naphthalen-1-ylethyl)benzamide |
| SMILES | O=C(NCC(O)c1cccc2ccccc12)c1ccccc1Cl |
| InChI | InChI=1S/C19H16ClNO2/c20-17-11-4-3-9-16(17)19(23)21-12-18(22)15-10-5-7-13-6-1-2-8-14(13)15/h1-11,18,22H,12H2,(H,21,23) |
| InChIKey | HIYTZVBXVLBDSV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |