C16H13ClF3NO2 — CID 56764204
2-chloro-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)benzamide (PubChem CID 56764204) has the molecular formula C16H13ClF3NO2 and a molecular weight of 343.73 g/mol. Its IUPAC name is 2-chloro-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)benzamide.
| Compound Name | 2-chloro-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 56764204 |
| Molecular Formula | C16H13ClF3NO2 |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-chloro-N-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)benzamide |
| SMILES | O=C(NCC(O)(c1ccccc1)C(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C16H13ClF3NO2/c17-13-9-5-4-8-12(13)14(22)21-10-15(23,16(18,19)20)11-6-2-1-3-7-11/h1-9,23H,10H2,(H,21,22) |
| InChIKey | JAAVBIWFWUZRLF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |