C26H30N2O5 — CID 11532494
(2R,3R)-N-benzyl-2,3-dihydroxy-N-methyl-N'-(4-naphthalen-1-yloxybutyl)butanediamide (PubChem CID 11532494) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is (2R,3R)-N-benzyl-2,3-dihydroxy-N-methyl-N'-(4-naphthalen-1-yloxybutyl)butanediamide.
| Compound Name | (2R,3R)-N-benzyl-2,3-dihydroxy-N-methyl-N'-(4-naphthalen-1-yloxybutyl)butanediamide |
|---|---|
| PubChem CID | 11532494 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (2R,3R)-N-benzyl-2,3-dihydroxy-N-methyl-N'-(4-naphthalen-1-yloxybutyl)butanediamide |
| SMILES | CN(Cc1ccccc1)C(=O)[C@H](O)[C@@H](O)C(=O)NCCCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C26H30N2O5/c1-28(18-19-10-3-2-4-11-19)26(32)24(30)23(29)25(31)27-16-7-8-17-33-22-15-9-13-20-12-5-6-14-21(20)22/h2-6,9-15,23-24,29-30H,7-8,16-18H2,1H3,(H,27,31)/t23-,24-/m1/s1 |
| InChIKey | WSDVEPOFUOQABB-DNQXCXABSA-N |
| XLogP | 2.50 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|