C9H9ClN2O2S — CID 115329264
4-amino-3-chloro-N-prop-2-ynylbenzenesulfonamide (PubChem CID 115329264) has the molecular formula C9H9ClN2O2S and a molecular weight of 244.70 g/mol. Its IUPAC name is 4-amino-3-chloro-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 4-amino-3-chloro-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 115329264 |
| Molecular Formula | C9H9ClN2O2S |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 4-amino-3-chloro-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C9H9ClN2O2S/c1-2-5-12-15(13,14)7-3-4-9(11)8(10)6-7/h1,3-4,6,12H,5,11H2 |
| InChIKey | WIBYTYOUVSPEOO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|