C13H15ClN3O2S+ — CID 70579139
4-amino-3-chloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide (PubChem CID 70579139) has the molecular formula C13H15ClN3O2S+ and a molecular weight of 312.80 g/mol. Its IUPAC name is 4-amino-3-chloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-amino-3-chloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 70579139 |
| Molecular Formula | C13H15ClN3O2S+ |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 4-amino-3-chloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCC[n+]2ccccc2)cc1Cl |
| InChI | InChI=1S/C13H15ClN3O2S/c14-12-10-11(4-5-13(12)15)20(18,19)16-6-9-17-7-2-1-3-8-17/h1-5,7-8,10,16H,6,9,15H2/q+1 |
| InChIKey | MWAAKGCJJFOAJN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|