C13H14Cl3N3O2S — CID 70578779
4-amino-2,5-dichloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide chloride (PubChem CID 70578779) has the molecular formula C13H14Cl3N3O2S and a molecular weight of 382.70 g/mol. Its IUPAC name is 4-amino-2,5-dichloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide chloride.
| Compound Name | 4-amino-2,5-dichloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide chloride |
|---|---|
| PubChem CID | 70578779 |
| Molecular Formula | C13H14Cl3N3O2S |
| Molecular Weight | 382.70 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 4-amino-2,5-dichloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide chloride |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)NCC[n+]2ccccc2)cc1Cl.[Cl-] |
| InChI | InChI=1S/C13H14Cl2N3O2S.ClH/c14-10-9-13(11(15)8-12(10)16)21(19,20)17-4-7-18-5-2-1-3-6-18;/h1-3,5-6,8-9,17H,4,7,16H2;1H/q+1;/p-1 |
| InChIKey | LFBAKTDGXNECLS-UHFFFAOYSA-M |
| XLogP | -1.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.70 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|