C6H4Cl2FNO2S — CID 15333361
4-amino-2,5-dichlorobenzenesulfonyl fluoride (PubChem CID 15333361) has the molecular formula C6H4Cl2FNO2S and a molecular weight of 244.07 g/mol. Its IUPAC name is 4-amino-2,5-dichlorobenzenesulfonyl fluoride.
| Compound Name | 4-amino-2,5-dichlorobenzenesulfonyl fluoride |
|---|---|
| PubChem CID | 15333361 |
| Molecular Formula | C6H4Cl2FNO2S |
| Molecular Weight | 244.07 g/mol |
| Exact Mass | 242.93 |
| IUPAC Name | 4-amino-2,5-dichlorobenzenesulfonyl fluoride |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)F)cc1Cl |
| InChI | InChI=1S/C6H4Cl2FNO2S/c7-3-2-6(13(9,11)12)4(8)1-5(3)10/h1-2H,10H2 |
| InChIKey | ROQLZHMPKLDLQN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.07 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|