C13H14Cl2N3O2S+ — CID 70579718
4-amino-3,5-dichloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide (PubChem CID 70579718) has the molecular formula C13H14Cl2N3O2S+ and a molecular weight of 347.25 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-amino-3,5-dichloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 70579718 |
| Molecular Formula | C13H14Cl2N3O2S+ |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide |
| SMILES | Nc1c(Cl)cc(S(=O)(=O)NCC[n+]2ccccc2)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N3O2S/c14-11-8-10(9-12(15)13(11)16)21(19,20)17-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-9,17H,4,7,16H2/q+1 |
| InChIKey | WLVPFIDSZVAHRL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|