C12H12Cl2N4O2S — CID 67543687
3-chloro-5-(3,4-diamino-5-chlorophenyl)sulfonylbenzene-1,2-diamine (PubChem CID 67543687) has the molecular formula C12H12Cl2N4O2S and a molecular weight of 347.23 g/mol. Its IUPAC name is 3-chloro-5-(3,4-diamino-5-chlorophenyl)sulfonylbenzene-1,2-diamine.
| Compound Name | 3-chloro-5-(3,4-diamino-5-chlorophenyl)sulfonylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 67543687 |
| Molecular Formula | C12H12Cl2N4O2S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 3-chloro-5-(3,4-diamino-5-chlorophenyl)sulfonylbenzene-1,2-diamine |
| SMILES | Nc1cc(S(=O)(=O)c2cc(N)c(N)c(Cl)c2)cc(Cl)c1N |
| InChI | InChI=1S/C12H12Cl2N4O2S/c13-7-1-5(3-9(15)11(7)17)21(19,20)6-2-8(14)12(18)10(16)4-6/h1-4H,15-18H2 |
| InChIKey | NNSJWJIHAYTCCR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|