C12H12N2O6S — CID 22184164
2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol (PubChem CID 22184164) has the molecular formula C12H12N2O6S and a molecular weight of 312.30 g/mol. Its IUPAC name is 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol.
| Compound Name | 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol |
|---|---|
| PubChem CID | 22184164 |
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol |
| SMILES | Nc1c(O)cc(S(=O)(=O)c2cc(O)c(N)c(O)c2)cc1O |
| InChI | InChI=1S/C12H12N2O6S/c13-11-7(15)1-5(2-8(11)16)21(19,20)6-3-9(17)12(14)10(18)4-6/h1-4,15-18H,13-14H2 |
| InChIKey | PVBNJHQVJXLQRQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|