About 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol
2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol (PubChem CID 22184164) has the molecular formula C12H12N2O6S
and a molecular weight of 312.30 g/mol. Its IUPAC name is 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol.
Molecular Properties
| Compound Name | 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol |
| PubChem CID | 22184164 |
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol |
| SMILES | Nc1c(O)cc(S(=O)(=O)c2cc(O)c(N)c(O)c2)cc1O |
| InChI | InChI=1S/C12H12N2O6S/c13-11-7(15)1-5(2-8(11)16)21(19,20)6-3-9(17)12(14)10(18)4-6/h1-4,15-18H,13-14H2 |
| InChIKey | PVBNJHQVJXLQRQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol?
The IUPAC name of 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol (CID 22184164) is 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol.
What is the SMILES notation for 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol?
The canonical SMILES for 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol is Nc1c(O)cc(S(=O)(=O)c2cc(O)c(N)c(O)c2)cc1O.
What is the InChIKey of 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol?
The InChIKey is PVBNJHQVJXLQRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O6S/c13-11-7(15)1-5(2-8(11)16)21(19,20)6-3-9(17)12(14)10(18)4-6/h1-4,15-18H,13-14H2.
What are the key properties of 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol?
2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol has a molecular weight of 312.30 g/mol, XLogP of 0.51, 2 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(4-amino-3,5-dihydroxyphenyl)sulfonylbenzene-1,3-diol is sourced from PubChem (CID 22184164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).