C13H12N2O5 — CID 151612756
bis(4-amino-3,5-dihydroxyphenyl)methanone (PubChem CID 151612756) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is bis(4-amino-3,5-dihydroxyphenyl)methanone.
| Compound Name | bis(4-amino-3,5-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 151612756 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | bis(4-amino-3,5-dihydroxyphenyl)methanone |
| SMILES | Nc1c(O)cc(C(=O)c2cc(O)c(N)c(O)c2)cc1O |
| InChI | InChI=1S/C13H12N2O5/c14-11-7(16)1-5(2-8(11)17)13(20)6-3-9(18)12(15)10(19)4-6/h1-4,16-19H,14-15H2 |
| InChIKey | QMVWWAFRRUVCIQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|