C9H10N2O5 — CID 140974704
2-[(4-amino-3,5-dihydroxybenzoyl)amino]acetic acid (PubChem CID 140974704) has the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-[(4-amino-3,5-dihydroxybenzoyl)amino]acetic acid.
| Compound Name | 2-[(4-amino-3,5-dihydroxybenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 140974704 |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-[(4-amino-3,5-dihydroxybenzoyl)amino]acetic acid |
| SMILES | Nc1c(O)cc(C(=O)NCC(=O)O)cc1O |
| InChI | InChI=1S/C9H10N2O5/c10-8-5(12)1-4(2-6(8)13)9(16)11-3-7(14)15/h1-2,12-13H,3,10H2,(H,11,16)(H,14,15) |
| InChIKey | DMUVCOLYXKXPRA-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|