C8H8N2O5 — CID 24711531
2-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]acetic acid (PubChem CID 24711531) has the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. Its IUPAC name is 2-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]acetic acid.
| Compound Name | 2-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 24711531 |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 2-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cc(O)[nH]c(=O)c1 |
| InChI | InChI=1S/C8H8N2O5/c11-5-1-4(2-6(12)10-5)8(15)9-3-7(13)14/h1-2H,3H2,(H,9,15)(H,13,14)(H2,10,11,12) |
| InChIKey | INHBFKHVJGFKDD-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |