C14H10EuO8S2 — CID 136597984
europium(2+);bis(3,4,5-trihydroxythiobenzate) (PubChem CID 136597984) has the molecular formula C14H10EuO8S2 and a molecular weight of 522.32 g/mol. Its IUPAC name is europium(2+);bis(3,4,5-trihydroxythiobenzate).
| Compound Name | europium(2+);bis(3,4,5-trihydroxythiobenzate) |
|---|---|
| PubChem CID | 136597984 |
| Molecular Formula | C14H10EuO8S2 |
| Molecular Weight | 522.32 g/mol |
| Exact Mass | 522.90 |
| IUPAC Name | europium(2+);bis(3,4,5-trihydroxythiobenzate) |
| SMILES | O=C([S-])c1cc(O)c(O)c(O)c1.O=C([S-])c1cc(O)c(O)c(O)c1.[Eu+2] |
| InChI | InChI=1S/2C7H6O4S.Eu/c2*8-4-1-3(7(11)12)2-5(9)6(4)10;/h2*1-2,8-10H,(H,11,12);/q;;+2/p-2 |
| InChIKey | TVFHDPYBPXHHGK-UHFFFAOYSA-L |
| XLogP | 0.98 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|