C6H8Cl4N2 — CID 17385558
3,5-dichlorobenzene-1,2-diamine;dihydrochloride (PubChem CID 17385558) has the molecular formula C6H8Cl4N2 and a molecular weight of 249.96 g/mol. Its IUPAC name is 3,5-dichlorobenzene-1,2-diamine;dihydrochloride.
| Compound Name | 3,5-dichlorobenzene-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17385558 |
| Molecular Formula | C6H8Cl4N2 |
| Molecular Weight | 249.96 g/mol |
| Exact Mass | 247.94 |
| IUPAC Name | 3,5-dichlorobenzene-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cc(Cl)cc(Cl)c1N |
| InChI | InChI=1S/C6H6Cl2N2.2ClH/c7-3-1-4(8)6(10)5(9)2-3;;/h1-2H,9-10H2;2*1H |
| InChIKey | IFEJKSNRKVRTAI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.96 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|