C13H7Cl6N — CID 139635169
bis(2,4,6-trichlorophenyl)methanamine (PubChem CID 139635169) has the molecular formula C13H7Cl6N and a molecular weight of 389.92 g/mol. Its IUPAC name is bis(2,4,6-trichlorophenyl)methanamine.
| Compound Name | bis(2,4,6-trichlorophenyl)methanamine |
|---|---|
| PubChem CID | 139635169 |
| Molecular Formula | C13H7Cl6N |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 386.87 |
| IUPAC Name | bis(2,4,6-trichlorophenyl)methanamine |
| SMILES | NC(c1c(Cl)cc(Cl)cc1Cl)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl6N/c14-5-1-7(16)11(8(17)2-5)13(20)12-9(18)3-6(15)4-10(12)19/h1-4,13H,20H2 |
| InChIKey | DTPUOYAJOFEFBG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |