C7H6Cl2N2S — CID 5384826
2-amino-3,5-dichlorobenzenecarbothioamide (PubChem CID 5384826) has the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. Its IUPAC name is 2-amino-3,5-dichlorobenzenecarbothioamide.
| Compound Name | 2-amino-3,5-dichlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 5384826 |
| Molecular Formula | C7H6Cl2N2S |
| Molecular Weight | 221.11 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | 2-amino-3,5-dichlorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(Cl)cc(Cl)c1N |
| InChI | InChI=1S/C7H6Cl2N2S/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,10H2,(H2,11,12) |
| InChIKey | TZRCZJAHHHDJIP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.11 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|