C7H4BrCl2NS — CID 134588977
2-bromo-4,5-dichlorobenzenecarbothioamide (PubChem CID 134588977) has the molecular formula C7H4BrCl2NS and a molecular weight of 284.99 g/mol. Its IUPAC name is 2-bromo-4,5-dichlorobenzenecarbothioamide.
| Compound Name | 2-bromo-4,5-dichlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 134588977 |
| Molecular Formula | C7H4BrCl2NS |
| Molecular Weight | 284.99 g/mol |
| Exact Mass | 282.86 |
| IUPAC Name | 2-bromo-4,5-dichlorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(Cl)c(Cl)cc1Br |
| InChI | InChI=1S/C7H4BrCl2NS/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H2,11,12) |
| InChIKey | CLSXPCXDYWYMEZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.99 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|