C7H3Cl4NS — CID 54290257
2,3,4,5-tetrachlorobenzenecarbothioamide (PubChem CID 54290257) has the molecular formula C7H3Cl4NS and a molecular weight of 274.99 g/mol. Its IUPAC name is 2,3,4,5-tetrachlorobenzenecarbothioamide.
| Compound Name | 2,3,4,5-tetrachlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 54290257 |
| Molecular Formula | C7H3Cl4NS |
| Molecular Weight | 274.99 g/mol |
| Exact Mass | 272.87 |
| IUPAC Name | 2,3,4,5-tetrachlorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl4NS/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1H,(H2,12,13) |
| InChIKey | RWZUAUISPOFUMB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.99 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|