C11H11Cl2N3O — CID 122583229
2-amino-3,5-dichloro-N-(2-cyanopropan-2-yl)benzamide (PubChem CID 122583229) has the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. Its IUPAC name is 2-amino-3,5-dichloro-N-(2-cyanopropan-2-yl)benzamide.
| Compound Name | 2-amino-3,5-dichloro-N-(2-cyanopropan-2-yl)benzamide |
|---|---|
| PubChem CID | 122583229 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-amino-3,5-dichloro-N-(2-cyanopropan-2-yl)benzamide |
| SMILES | CC(C)(C#N)NC(=O)c1cc(Cl)cc(Cl)c1N |
| InChI | InChI=1S/C11H11Cl2N3O/c1-11(2,5-14)16-10(17)7-3-6(12)4-8(13)9(7)15/h3-4H,15H2,1-2H3,(H,16,17) |
| InChIKey | XNIVFVUARXRUHU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|