C13H16ClN3O2S — CID 70585913
4-amino-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide chloride (PubChem CID 70585913) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 4-amino-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide chloride.
| Compound Name | 4-amino-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide chloride |
|---|---|
| PubChem CID | 70585913 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-amino-N-(2-pyridin-1-ium-1-ylethyl)benzenesulfonamide chloride |
| SMILES | Nc1ccc(S(=O)(=O)NCC[n+]2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C13H16N3O2S.ClH/c14-12-4-6-13(7-5-12)19(17,18)15-8-11-16-9-2-1-3-10-16;/h1-7,9-10,15H,8,11,14H2;1H/q+1;/p-1 |
| InChIKey | KUXPDCRQIJFYMR-UHFFFAOYSA-M |
| XLogP | -2.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|