C11H16N4S2 — CID 115331844
2-[imidazo[2,1-b][1,3]thiazol-6-ylmethyl(propyl)amino]ethanethioamide (PubChem CID 115331844) has the molecular formula C11H16N4S2 and a molecular weight of 268.41 g/mol. Its IUPAC name is 2-[imidazo[2,1-b][1,3]thiazol-6-ylmethyl(propyl)amino]ethanethioamide.
| Compound Name | 2-[imidazo[2,1-b][1,3]thiazol-6-ylmethyl(propyl)amino]ethanethioamide |
|---|---|
| PubChem CID | 115331844 |
| Molecular Formula | C11H16N4S2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[imidazo[2,1-b][1,3]thiazol-6-ylmethyl(propyl)amino]ethanethioamide |
| SMILES | CCCN(CC(N)=S)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C11H16N4S2/c1-2-3-14(8-10(12)16)6-9-7-15-4-5-17-11(15)13-9/h4-5,7H,2-3,6,8H2,1H3,(H2,12,16) |
| InChIKey | ZWWXKMVGHTUKBK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|