C14H10N2O4S — CID 115331928
6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-1,3-benzodioxole-5-carbaldehyde (PubChem CID 115331928) has the molecular formula C14H10N2O4S and a molecular weight of 302.31 g/mol. Its IUPAC name is 6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 115331928 |
| Molecular Formula | C14H10N2O4S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 6-(imidazo[2,1-b][1,3]thiazol-6-ylmethoxy)-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=Cc1cc2c(cc1OCc1cn3ccsc3n1)OCO2 |
| InChI | InChI=1S/C14H10N2O4S/c17-6-9-3-12-13(20-8-19-12)4-11(9)18-7-10-5-16-1-2-21-14(16)15-10/h1-6H,7-8H2 |
| InChIKey | LJYFDJZZQPMTHJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|