C10H17NO3S — CID 115338161
3-(3-hydroxypentan-3-yl)-1,1-dioxothiolane-3-carbonitrile (PubChem CID 115338161) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-(3-hydroxypentan-3-yl)-1,1-dioxothiolane-3-carbonitrile.
| Compound Name | 3-(3-hydroxypentan-3-yl)-1,1-dioxothiolane-3-carbonitrile |
|---|---|
| PubChem CID | 115338161 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-(3-hydroxypentan-3-yl)-1,1-dioxothiolane-3-carbonitrile |
| SMILES | CCC(O)(CC)C1(C#N)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17NO3S/c1-3-10(12,4-2)9(7-11)5-6-15(13,14)8-9/h12H,3-6,8H2,1-2H3 |
| InChIKey | QUJQSNMNDSTLOC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |