C10H15NO2S — CID 130514383
3-(2-methylidenebutyl)-1,1-dioxothiolane-3-carbonitrile (PubChem CID 130514383) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 3-(2-methylidenebutyl)-1,1-dioxothiolane-3-carbonitrile.
| Compound Name | 3-(2-methylidenebutyl)-1,1-dioxothiolane-3-carbonitrile |
|---|---|
| PubChem CID | 130514383 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3-(2-methylidenebutyl)-1,1-dioxothiolane-3-carbonitrile |
| SMILES | C=C(CC)CC1(C#N)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15NO2S/c1-3-9(2)6-10(7-11)4-5-14(12,13)8-10/h2-6,8H2,1H3 |
| InChIKey | AKQPBCNJFBSNTM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|