C16H19N5 — CID 115339652
2-[2-(4-aminophenyl)ethyl]-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 115339652) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)ethyl]-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-[2-(4-aminophenyl)ethyl]-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 115339652 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[2-(4-aminophenyl)ethyl]-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CN(C)c1ccc2[nH]c(CCc3ccc(N)cc3)nc2n1 |
| InChI | InChI=1S/C16H19N5/c1-21(2)15-10-8-13-16(20-15)19-14(18-13)9-5-11-3-6-12(17)7-4-11/h3-4,6-8,10H,5,9,17H2,1-2H3,(H,18,19,20) |
| InChIKey | CGMRFSQYJWEPSX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|