C16H18N4O — CID 79817092
N,N-dimethyl-2-(2-phenoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79817092) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-phenoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | N,N-dimethyl-2-(2-phenoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79817092 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N,N-dimethyl-2-(2-phenoxyethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CN(C)c1ccc2[nH]c(CCOc3ccccc3)nc2n1 |
| InChI | InChI=1S/C16H18N4O/c1-20(2)15-9-8-13-16(19-15)18-14(17-13)10-11-21-12-6-4-3-5-7-12/h3-9H,10-11H2,1-2H3,(H,17,18,19) |
| InChIKey | JRABIIXPQXDFQI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |