C14H13N3O — CID 81137537
5-methyl-2-(phenoxymethyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 81137537) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 5-methyl-2-(phenoxymethyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-methyl-2-(phenoxymethyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 81137537 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 5-methyl-2-(phenoxymethyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc2[nH]c(COc3ccccc3)nc2n1 |
| InChI | InChI=1S/C14H13N3O/c1-10-7-8-12-14(15-10)17-13(16-12)9-18-11-5-3-2-4-6-11/h2-8H,9H2,1H3,(H,15,16,17) |
| InChIKey | LGTUSVCRSRINNA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |