C14H15N5O — CID 79821122
2-[(4-aminophenoxy)methyl]-N-methyl-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79821122) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-[(4-aminophenoxy)methyl]-N-methyl-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-[(4-aminophenoxy)methyl]-N-methyl-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79821122 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[(4-aminophenoxy)methyl]-N-methyl-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CNc1ccc2[nH]c(COc3ccc(N)cc3)nc2n1 |
| InChI | InChI=1S/C14H15N5O/c1-16-12-7-6-11-14(18-12)19-13(17-11)8-20-10-4-2-9(15)3-5-10/h2-7H,8,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | CEDVAEOIEJCWRY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|