C8H10N4O — CID 79821303
2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79821303) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79821303 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | COCc1nc2nc(N)ccc2[nH]1 |
| InChI | InChI=1S/C8H10N4O/c1-13-4-7-10-5-2-3-6(9)11-8(5)12-7/h2-3H,4H2,1H3,(H3,9,10,11,12) |
| InChIKey | GYBWMTLWRKPVTM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |