About 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine
2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79821303) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| PubChem CID | 79821303 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | COCc1nc2nc(N)ccc2[nH]1 |
| InChI | InChI=1S/C8H10N4O/c1-13-4-7-10-5-2-3-6(9)11-8(5)12-7/h2-3H,4H2,1H3,(H3,9,10,11,12) |
| InChIKey | GYBWMTLWRKPVTM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The IUPAC name of 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine (CID 79821303) is 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
What is the SMILES notation for 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The canonical SMILES for 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine is COCc1nc2nc(N)ccc2[nH]1.
What is the InChIKey of 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The InChIKey is GYBWMTLWRKPVTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-13-4-7-10-5-2-3-6(9)11-8(5)12-7/h2-3H,4H2,1H3,(H3,9,10,11,12).
What are the key properties of 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine has a molecular weight of 178.19 g/mol, XLogP of 0.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-1H-imidazo[4,5-b]pyridin-5-amine is sourced from PubChem (CID 79821303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).