C13H13N5 — CID 79821282
2-[(2-aminophenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79821282) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-[(2-aminophenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-[(2-aminophenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79821282 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-[(2-aminophenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | Nc1ccc2[nH]c(Cc3ccccc3N)nc2n1 |
| InChI | InChI=1S/C13H13N5/c14-9-4-2-1-3-8(9)7-12-16-10-5-6-11(15)17-13(10)18-12/h1-6H,7,14H2,(H3,15,16,17,18) |
| InChIKey | XSUKCJYVERTNGI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|