C14H14N4 — CID 79821064
2-[(4-methylphenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79821064) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-[(4-methylphenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79821064 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | Cc1ccc(Cc2nc3nc(N)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C14H14N4/c1-9-2-4-10(5-3-9)8-13-16-11-6-7-12(15)17-14(11)18-13/h2-7H,8H2,1H3,(H3,15,16,17,18) |
| InChIKey | DTRQOYGHINQUCB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |