C13H12N4O — CID 80741043
2-[(5-amino-1H-imidazo[4,5-b]pyridin-2-yl)methyl]phenol (PubChem CID 80741043) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-[(5-amino-1H-imidazo[4,5-b]pyridin-2-yl)methyl]phenol.
| Compound Name | 2-[(5-amino-1H-imidazo[4,5-b]pyridin-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 80741043 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-[(5-amino-1H-imidazo[4,5-b]pyridin-2-yl)methyl]phenol |
| SMILES | Nc1ccc2[nH]c(Cc3ccccc3O)nc2n1 |
| InChI | InChI=1S/C13H12N4O/c14-11-6-5-9-13(16-11)17-12(15-9)7-8-3-1-2-4-10(8)18/h1-6,18H,7H2,(H3,14,15,16,17) |
| InChIKey | ZTYOIWNCMLETKU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |