C11H17N5 — CID 79820779
2-(5-aminopentyl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79820779) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(5-aminopentyl)-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-(5-aminopentyl)-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79820779 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-(5-aminopentyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | NCCCCCc1nc2nc(N)ccc2[nH]1 |
| InChI | InChI=1S/C11H17N5/c12-7-3-1-2-4-10-14-8-5-6-9(13)15-11(8)16-10/h5-6H,1-4,7,12H2,(H3,13,14,15,16) |
| InChIKey | ZFPHIPBOQRYEEW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|