C14H23N5 — CID 79821623
2-[3-(2-aminoethyl)hexyl]-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79821623) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-[3-(2-aminoethyl)hexyl]-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-[3-(2-aminoethyl)hexyl]-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79821623 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 2-[3-(2-aminoethyl)hexyl]-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CCCC(CCN)CCc1nc2nc(N)ccc2[nH]1 |
| InChI | InChI=1S/C14H23N5/c1-2-3-10(8-9-15)4-7-13-17-11-5-6-12(16)18-14(11)19-13/h5-6,10H,2-4,7-9,15H2,1H3,(H3,16,17,18,19) |
| InChIKey | PKZIPXZRTOECQS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |