C8H10N4O2S — CID 79821236
2-(methylsulfonylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79821236) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-(methylsulfonylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-(methylsulfonylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79821236 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-(methylsulfonylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CS(=O)(=O)Cc1nc2nc(N)ccc2[nH]1 |
| InChI | InChI=1S/C8H10N4O2S/c1-15(13,14)4-7-10-5-2-3-6(9)11-8(5)12-7/h2-3H,4H2,1H3,(H3,9,10,11,12) |
| InChIKey | TYCFJYKPGYYIAM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |