About oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate
oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate (PubChem CID 115342528) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate |
| PubChem CID | 115342528 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate |
| SMILES | Nc1ccc(/C=C/C(=O)OC2CCOC2)cc1 |
| InChI | InChI=1S/C13H15NO3/c14-11-4-1-10(2-5-11)3-6-13(15)17-12-7-8-16-9-12/h1-6,12H,7-9,14H2/b6-3+ |
| InChIKey | DNBLLXHNQGNZJI-ZZXKWVIFSA-N |
| XLogP | 1.61 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate?
The IUPAC name of oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate (CID 115342528) is oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate.
What is the SMILES notation for oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate?
The canonical SMILES for oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate is Nc1ccc(/C=C/C(=O)OC2CCOC2)cc1.
What is the InChIKey of oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate?
The InChIKey is DNBLLXHNQGNZJI-ZZXKWVIFSA-N. The full InChI is InChI=1S/C13H15NO3/c14-11-4-1-10(2-5-11)3-6-13(15)17-12-7-8-16-9-12/h1-6,12H,7-9,14H2/b6-3+.
What are the key properties of oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate?
oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate has a molecular weight of 233.27 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl (E)-3-(4-aminophenyl)prop-2-enoate is sourced from PubChem (CID 115342528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).