C13H22N2 — CID 115347408
4-(2-amino-3-methylbutyl)-N,N-dimethylaniline (PubChem CID 115347408) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 4-(2-amino-3-methylbutyl)-N,N-dimethylaniline.
| Compound Name | 4-(2-amino-3-methylbutyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 115347408 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 4-(2-amino-3-methylbutyl)-N,N-dimethylaniline |
| SMILES | CC(C)C(N)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H22N2/c1-10(2)13(14)9-11-5-7-12(8-6-11)15(3)4/h5-8,10,13H,9,14H2,1-4H3 |
| InChIKey | ITJJMVVIJBMUTM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|